Dextropropoxyphene
(QMQBBUPJKANITL-MYXGOWFTSA-N)
Structure
- SMILES
- CCC(=O)O[C@](c1ccccc1)([C@@H](CN(C)C)C)Cc1ccccc1.Cl
- Molecular Formula:
- C22H30ClNO2
- Molecular Weight:
- 375.932
- Log P:
- 5.0775
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 29.54
- CAS Number(s):
- 1639-60-7
Synonym(s)
1.
Dextropropoxyphene
2.
D-Propoxyphene
3.
Darvon
4.
Propoxyphene
5.
Propoxyphene Hydrochloride
6.
Propoxyphene Hydrochloride, (R*,R*)-(+-)-Isomer
7.
Propoxyphene Hydrochloride, (R-(R*,R*))-Isomer
8.
Propoxyphene Hydrochloride, (R-(R*,S*))-Isomer
9.
Propoxyphene Hydrochloride, (S-(R*,R*))-Isomer
10.
Propoxyphene Maleate, (+)-Isomer
11.
Propoxyphene Phosphate, (S-(R*,S*))-Isomer
12.
Propoxyphene Sulfate, (S-(R*,S*))-Isomer
13.
D Propoxyphene
14.
Hydrochloride, Propoxyphene
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Palpitations | FAERS: 11 | US FAERS | |
| 3 | Product quality issue | FAERS: 10 | US FAERS | |
| 4 | Chest Pain | FAERS: 7 | US FAERS | |
| 5 | Myocardial Infarction | FAERS: 7 | US FAERS | |
| 6 | Drug ineffective | FAERS: 6 | US FAERS | |
| 7 | Nausea | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Syncope | FAERS: 5 | US FAERS | |
| 9 | Asthenia | FAERS: 3 | US FAERS | |
| 10 | Drug toxicity | FAERS: 3 | US FAERS | |
| 11 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 12 | Pruritus | FAERS: 3 | US FAERS | |
| 13 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 14 | Accidental overdose | FAERS: 2 | US FAERS | |
| 15 | Apparent death | FAERS: 2 | US FAERS | |
| 16 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 17 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 18 | Chest discomfort | FAERS: 2 | US FAERS | |
| 19 | Completed Suicide | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 21 | Malaise | FAERS: 2 | US FAERS | |
| 22 | Medication Error | FAERS: 2 | US FAERS | |
| 23 | Pain | FAERS: 2 | US FAERS | |
| 24 | Thrombosis | FAERS: 2 | US FAERS | |
| 25 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 26 | Anxiety | FAERS: 1 | US FAERS | |
| 27 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 28 | Asthma | FAERS: 1 | US FAERS | |
| 29 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 30 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 31 | Cholestasis | FAERS: 1 | US FAERS | |
| 32 | Chromaturia | FAERS: 1 | US FAERS | |
| 33 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 34 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 35 | Erythema | FAERS: 1 | US FAERS | |
| 36 | Fatigue | FAERS: 1 | US FAERS | |
| 37 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 38 | Headache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 41 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 42 | Laceration | FAERS: 1 | US FAERS | |
| 43 | Memory impairment | FAERS: 1 | US FAERS | |
| 44 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 45 | Personality Change | FAERS: 1 | US FAERS | |
| 46 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 47 | Presyncope | FAERS: 1 | US FAERS | |
| 48 | Skin laceration | FAERS: 1 | US FAERS | |
| 49 | Somnolence | FAERS: 1 | US FAERS | |
| 50 | Tachycardia | FAERS: 1 | US FAERS | |
| 51 | Urticaria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | jaundice | FAERS: 1 | US FAERS | |
| 53 | Diplopia | Canada Vigilance: 1 | Canada Vigilance | |
| 54 | Vomiting | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.