Budesonide and formoterol fumarate dihydrate
(PJFHZKIDENOSJB-JIVDDGRNSA-N)
Structure
- SMILES
- O=CNc1cc(ccc1O)[C@@H](CN[C@H](Cc1ccc(cc1)OC)C)O.CCCC1O[C@H]2[C@](O1)(C(=O)CO)[C@@]1([C@@H](C2)[C@@H]2CCC3=CC(=O)C=C[C@@]3([C@H]2[C@H](C1)O)C)C
- Molecular Formula:
- C44H58N2O10
- Molecular Weight:
- 774.939
- Log P:
- 6.0399
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 6
- TPSA:
- 183.88
- CAS Number(s):
- 150693-37-1
Synonym(s)
1.
Budesonide and formoterol fumarate dihydrate
External Link(s)
| PubChem Compound | 56841116 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Angioedema | FAERS: 4 | US FAERS | |
| 2 | Nausea | FAERS: 2 | US FAERS | |
| 3 | Vomiting | FAERS: 2 | US FAERS | |
| 4 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 5 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 6 | Ageusia | FAERS: 1 | US FAERS | |
| 7 | Dermatitis | FAERS: 1 | US FAERS | |
| 8 | Dizziness | FAERS: 1 | US FAERS | |
| 9 | Headache | FAERS: 1 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 11 | Myalgia | FAERS: 1 | US FAERS | |
| 12 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 13 | Palpitations | FAERS: 1 | US FAERS | |
| 14 | Throat irritation | FAERS: 1 | US FAERS | |
| 15 | Upper airway obstruction | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.