Dextrose 10% and sodium chloride 0.11% IN plastic container
(PHPHRWZFQRLJIA-UHFFFAOYSA-M)
Structure
- SMILES
- OCC1OC(O)C(C(C1O)O)O.[Na+].[Cl-]
- Molecular Formula:
- C6H12ClNaO6
- Molecular Weight:
- 238.599
- Log P:
- -6.2174
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 5
- TPSA:
- 110.38
- CAS Number(s):
- N/A
Synonym(s)
1.
Dextrose 10% and sodium chloride 0.11% IN plastic container
External Link(s)
| PubChem Compound | 24848152 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Chills | FAERS: 16 | US FAERS | |
| 2 | Cyanosis | FAERS: 7 | US FAERS | |
| 3 | Tremor | FAERS: 6 | US FAERS | |
| 4 | Back Pain | FAERS: 1 | US FAERS | |
| 5 | Device Failure | FAERS: 1 | US FAERS | |
| 6 | Device leakage | FAERS: 1 | US FAERS | |
| 7 | Extravasation | FAERS: 1 | US FAERS | |
| 8 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 9 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 10 | Medication Error | FAERS: 1 | US FAERS | |
| 11 | Pyoderma | FAERS: 1 | US FAERS | |
| 12 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 13 | Unresponsive to stimuli | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.