gadolinium ethoxybenzyl DTPA
(PCZHWPSNPWAQNF-UHFFFAOYSA-N)
Structure
- SMILES
- CCOc1ccc(cc1)CC(N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)CC(=O)O.[Gd+3]
- Molecular Formula:
- C23H33GdN3O11+++
- Molecular Weight:
- 684.772
- Log P:
- -0.6746
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 5
- TPSA:
- 205.45
- CAS Number(s):
- N/A
Synonym(s)
1.
gadolinium ethoxybenzyl DTPA
2.
Eovist
3.
Gd-EOB-DTPA
4.
Primovist
5.
disodium gadoxetate
6.
gadolinium (4S)-4-(4-ethoxybenzyl)-3,6,9-tris(carboxylatomethyl)-3,6,9-triazaundecanoic acid disodium salt
7.
gadolinium ethoxybenzyl diethylenetriaminepentaacetic acid
8.
gadoxetate disodium
9.
gadoxetic acid
10.
gadoxetic acid disodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 10 | US FAERS | |
| 4 | Pruritus | FAERS: 7 | US FAERS | |
| 5 | Erythema | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 6 | Contrast media reaction | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Dizziness | FAERS: 4 | US FAERS | |
| 8 | Chest discomfort | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 3 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 11 | Arthralgia | FAERS: 2 | US FAERS | |
| 12 | Burning sensation | FAERS: 2 | US FAERS | |
| 13 | Chest Pain | FAERS: 2 | US FAERS | |
| 14 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 15 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 16 | Nontherapeutic agent urine positive | FAERS: 2 | US FAERS | |
| 17 | Respiratory distress | FAERS: 2 | US FAERS | |
| 18 | Sneezing | FAERS: 2 | US FAERS | |
| 19 | Tremor | FAERS: 2 | US FAERS | |
| 20 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 21 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 22 | Angioedema | FAERS: 1 | US FAERS | |
| 23 | Anhedonia | FAERS: 1 | US FAERS | |
| 24 | Anxiety | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Back Pain | FAERS: 1 | US FAERS | |
| 26 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 27 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 28 | Contrast media deposition | FAERS: 1 | US FAERS | |
| 29 | Cyanosis | FAERS: 1 | US FAERS | |
| 30 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 31 | Dry skin | FAERS: 1 | US FAERS | |
| 32 | Dysgeusia | FAERS: 1 | US FAERS | |
| 33 | Dysphonia | FAERS: 1 | US FAERS | |
| 34 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 35 | Extra dose administered | FAERS: 1 | US FAERS | |
| 36 | Extravasation | FAERS: 1 | US FAERS | |
| 37 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 38 | Flushing | FAERS: 1 | US FAERS | |
| 39 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 40 | Injection site pain | FAERS: 1 | US FAERS | |
| 41 | Irregular breathing | FAERS: 1 | US FAERS | |
| 42 | Joint stiffness | FAERS: 1 | US FAERS | |
| 43 | Malaise | FAERS: 1 | US FAERS | |
| 44 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 45 | Memory impairment | FAERS: 1 | US FAERS | |
| 46 | Mouth swelling | FAERS: 1 | US FAERS | |
| 47 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 48 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 49 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 50 | Pain | FAERS: 1 | US FAERS | |
| 51 | Palpitations | FAERS: 1 | US FAERS | |
| 52 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 53 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 54 | Respiratory arrest | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Retching | FAERS: 1 | US FAERS | |
| 56 | Swelling | FAERS: 1 | US FAERS | |
| 57 | Throat irritation | FAERS: 1 | US FAERS | |
| 58 | Unevaluable event | FAERS: 1 | US FAERS | |
| 59 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 60 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 61 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 62 | Cardiac Arrest | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Chills | Canada Vigilance: 2 | Canada Vigilance | |
| 64 | Musculoskeletal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 65 | Wheezing | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.