Echothiophate Iodide
(OVXQHPWHMXOFRD-UHFFFAOYSA-M)
Structure
- SMILES
- CCOP(=O)(SCC[N+](C)(C)C)OCC.[I-]
- Molecular Formula:
- C9H23INO3PS
- Molecular Weight:
- 383.227
- Log P:
- -0.3891
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 70.64
- CAS Number(s):
- 513-10-0
Synonym(s)
1.
Echothiophate Iodide
2.
Ecothiopate Iodide
3.
2-((Diethoxyphosphinyl)thio)-N,N,N,-trimethylethanaminium iodide
4.
Ecothiophate Iodide
5.
Phospholine Iodide
6.
Iodide, Echothiophate
7.
Iodide, Ecothiopate
8.
Iodide, Ecothiophate
9.
Iodide, Phospholine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blindness | FAERS: 5 | US FAERS | |
| 2 | Drug ineffective | FAERS: 5 | US FAERS | |
| 3 | Eye pain | FAERS: 5 | US FAERS | |
| 4 | Visual Impairment | FAERS: 5 | US FAERS | |
| 5 | Eye irritation | FAERS: 4 | US FAERS | |
| 6 | Headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Glaucoma | FAERS: 2 | 686974 7139452 | CTD US FAERS |
| 8 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 9 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 10 | Product quality issue | FAERS: 2 | US FAERS | |
| 11 | Asthenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Cataract | FAERS: 1 | US FAERS | |
| 13 | Chest Pain | FAERS: 1 | US FAERS | |
| 14 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 15 | Discomfort | FAERS: 1 | US FAERS | |
| 16 | Drug dose omission | FAERS: 1 | US FAERS | |
| 17 | Expired product administered | FAERS: 1 | US FAERS | |
| 18 | Malaise | FAERS: 1 | US FAERS | |
| 19 | Nausea | FAERS: 1 | US FAERS | |
| 20 | No adverse event | FAERS: 1 | US FAERS | |
| 21 | Pain | FAERS: 1 | US FAERS | |
| 22 | Pallor | FAERS: 1 | US FAERS | |
| 23 | Product container issue | FAERS: 1 | US FAERS | |
| 24 | Product dropper issue | FAERS: 1 | US FAERS | |
| 25 | Product packaging issue | FAERS: 1 | US FAERS | |
| 26 | Product use issue | FAERS: 1 | US FAERS | |
| 27 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 28 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 29 | Tremor | FAERS: 1 | US FAERS | |
| 30 | Vomiting | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 32 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 33 | Angina Pectoris | Canada Vigilance: 1 | Canada Vigilance | |
| 34 | Apnea | 686974 7139452 | CTD | |
| 35 | Floppy iris syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 36 | Glaucoma, Open-Angle | 1869061 | CTD | |
| 37 | Muscle Weakness | 7650771 | CTD | |
| 38 | Myalgia | Canada Vigilance: 1 | Canada Vigilance | |
| 39 | Necrosis | 6850293 | CTD | |
| 40 | Neuritis | Canada Vigilance: 1 | Canada Vigilance | |
| 41 | Ocular Hypertension | 15277498 | CTD | |
| 42 | Retinal Detachment | 1869061 | CTD | |
| 43 | Weight decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.