Cyclopar
(NWXMGUDVXFXRIG-NAOJVREFSA-N)
Structure
- SMILES
- CN([C@@H]1C(=O)C(=C([C@@]2([C@H]1C[C@H]1C(=C(O)c3c(C1(C)O)cccc3O)C2=O)O)O)C(=O)N)C
- Molecular Formula:
- C22H24N2O8
- Molecular Weight:
- 444.435
- Log P:
- 0.3293
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 6
- TPSA:
- 181.62
- CAS Number(s):
- N/A
Synonym(s)
1.
Cyclopar
External Link(s)
| PubChem Compound | 54699147 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Weight decreased | FAERS: 2 | US FAERS | |
| 2 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 3 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 4 | Flatulence | FAERS: 1 | US FAERS | |
| 5 | Incontinence | FAERS: 1 | US FAERS | |
| 6 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 7 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 8 | Urticaria | FAERS: 1 | US FAERS | |
| 9 | Dizziness | Canada Vigilance: 2 | Canada Vigilance | |
| 10 | Dyspepsia | Canada Vigilance: 1 | Canada Vigilance | |
| 11 | Nausea | Canada Vigilance: 1 | Canada Vigilance | |
| 12 | Pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 13 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 14 | Vomiting | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120265
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.