Doripenem hydrate
(NTUBEBXBDGKBTJ-WGLOMNHJSA-N)
Structure
- SMILES
- C[C@H]([C@H]1C(=O)N2[C@@H]1[C@@H](C)C(=C2C(=O)O)S[C@@H]1CN[C@@H](C1)CNS(=O)(=O)N)O.O
- Molecular Formula:
- C15H26N4O7S2
- Molecular Weight:
- 438.520
- Log P:
- 0.7713
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 6
- TPSA:
- 204.97
- CAS Number(s):
- 364622-82-2
Synonym(s)
1.
Doripenem hydrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 2 | Enteritis | FAERS: 2 | US FAERS | |
| 3 | Acidosis | FAERS: 1 | US FAERS | |
| 4 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 5 | Bradycardia | FAERS: 1 | US FAERS | |
| 6 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 7 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 8 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 9 | Leukopenia | FAERS: 1 | US FAERS | |
| 10 | Pancreatitis | FAERS: 1 | US FAERS | |
| 11 | Pneumonia | FAERS: 1 | US FAERS | |
| 12 | Sepsis | FAERS: 1 | US FAERS | |
| 13 | pseudomembranous colitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.