plecanatide
(NSPHQWLKCGGCQR-DLJDZFDSSA-N)
Structure
- SMILES
- OC(=O)CC[C@@H]1NC(=O)[C@H](CSSC[C@@H]2NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)CC(C)C)CSSC[C@H](NC(=O)CNC(=O)[C@@H](NC2=O)[C@H](O)C)C(=O)N[C@H](C(=O)O)CC(C)C)C(C)C)CC(=O)N)C(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)N)N)CC(=O)O)CCC(=O)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- A06AX07
- Molecular Formula:
- C65H104N18O26S4
- Molecular Weight:
- 1681.890
- Log P:
- -0.8670
- Hydrogen Bond Acceptor:
- 48
- Hydrogen Bond Donor:
- 23
- TPSA:
- 819.33
- CAS Number(s):
- 467426-54-6
Synonym(s)
1.
plecanatide
2.
SP-304
3.
Trulance
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 19 | US FAERS | |
| 2 | Drug ineffective | FAERS: 13 | US FAERS | |
| 3 | Abdominal Pain | FAERS: 12 | US FAERS | |
| 4 | Abdominal discomfort | FAERS: 10 | US FAERS | |
| 5 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 6 | Constipation | FAERS: 7 | US FAERS | |
| 7 | Malaise | FAERS: 7 | US FAERS | |
| 8 | Product use issue | FAERS: 7 | US FAERS | |
| 9 | Flatulence | FAERS: 6 | US FAERS | |
| 10 | Headache | FAERS: 6 | US FAERS | |
| 11 | Vomiting | FAERS: 6 | US FAERS | |
| 12 | Back Pain | FAERS: 5 | US FAERS | |
| 13 | Drug dose omission | FAERS: 5 | US FAERS | |
| 14 | Gastrointestinal sounds abnormal | FAERS: 5 | US FAERS | |
| 15 | Asthenia | FAERS: 4 | US FAERS | |
| 16 | Pain | FAERS: 4 | US FAERS | |
| 17 | Urticaria | FAERS: 4 | US FAERS | |
| 18 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 19 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 20 | Dehydration | FAERS: 3 | US FAERS | |
| 21 | Dizziness | FAERS: 3 | US FAERS | |
| 22 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 23 | Fatigue | FAERS: 3 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 25 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 26 | Influenza | FAERS: 3 | US FAERS | |
| 27 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 28 | Rectal tenesmus | FAERS: 3 | US FAERS | |
| 29 | Unevaluable event | FAERS: 3 | US FAERS | |
| 30 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 31 | Alopecia | FAERS: 2 | US FAERS | |
| 32 | Anxiety | FAERS: 2 | US FAERS | |
| 33 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 34 | Bronchitis | FAERS: 2 | US FAERS | |
| 35 | Burning sensation | FAERS: 2 | US FAERS | |
| 36 | Chest discomfort | FAERS: 2 | US FAERS | |
| 37 | Discomfort | FAERS: 2 | US FAERS | |
| 38 | Dysuria | FAERS: 2 | US FAERS | |
| 39 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 40 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 41 | Myalgia | FAERS: 2 | US FAERS | |
| 42 | Palpitations | FAERS: 2 | US FAERS | |
| 43 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 44 | Tinnitus | FAERS: 2 | US FAERS | |
| 45 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 46 | Accidental overdose | FAERS: 1 | US FAERS | |
| 47 | Adverse event | FAERS: 1 | US FAERS | |
| 48 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 49 | Arthralgia | FAERS: 1 | US FAERS | |
| 50 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 51 | Chills | FAERS: 1 | US FAERS | |
| 52 | Choking sensation | FAERS: 1 | US FAERS | |
| 53 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 54 | Dysgeusia | FAERS: 1 | US FAERS | |
| 55 | Dyspepsia | FAERS: 1 | US FAERS | |
| 56 | Erythema | FAERS: 1 | US FAERS | |
| 57 | Eye pain | FAERS: 1 | US FAERS | |
| 58 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 59 | Head discomfort | FAERS: 1 | US FAERS | |
| 60 | Hypophagia | FAERS: 1 | US FAERS | |
| 61 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 62 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 63 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 64 | Neck Pain | FAERS: 1 | US FAERS | |
| 65 | Nervousness | FAERS: 1 | US FAERS | |
| 66 | Oral pain | FAERS: 1 | US FAERS | |
| 67 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 68 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 69 | Proctitis | FAERS: 1 | US FAERS | |
| 70 | Product dose omission | FAERS: 1 | US FAERS | |
| 71 | Product physical issue | FAERS: 1 | US FAERS | |
| 72 | Product prescribing error | FAERS: 1 | US FAERS | |
| 73 | Pruritus | FAERS: 1 | US FAERS | |
| 74 | Rash erythematous | FAERS: 1 | US FAERS | |
| 75 | Sinusitis | FAERS: 1 | US FAERS | |
| 76 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 77 | Swelling | FAERS: 1 | US FAERS | |
| 78 | Syncope | FAERS: 1 | US FAERS | |
| 79 | Thirst | FAERS: 1 | US FAERS | |
| 80 | Throat irritation | FAERS: 1 | US FAERS | |
| 81 | Toothache | FAERS: 1 | US FAERS | |
| 82 | Tremor | FAERS: 1 | US FAERS | |
| 83 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 84 | Urinary Retention | FAERS: 1 | US FAERS | |
| 85 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 86 | Visual Impairment | FAERS: 1 | US FAERS | |
| 87 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 88 | Weight decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.