(+)-Menthol
(NOOLISFMXDJSKH-AEJSXWLSSA-N)
Structure
- SMILES
- C[C@H]1CC[C@@H]([C@H](C1)O)C(C)C
- Type(s)
- Experimental
- Molecular Formula:
- C10H20O
- Molecular Weight:
- 156.265
- Log P:
- 2.4395
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 1
- TPSA:
- 20.23
- CAS Number(s):
- 89-78-1; 15356-60-2
Synonym(s)
1.
(+)-Menthol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Expired drug administered | FAERS: 7 | US FAERS | |
| 2 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 3 | Bronchitis | FAERS: 2 | US FAERS | |
| 4 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 5 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 6 | Vomiting | FAERS: 2 | US FAERS | |
| 7 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 8 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 9 | Amnesia | FAERS: 1 | US FAERS | |
| 10 | Back Pain | FAERS: 1 | US FAERS | |
| 11 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 12 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 13 | Burning sensation | FAERS: 1 | US FAERS | |
| 14 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 15 | Chills | FAERS: 1 | US FAERS | |
| 16 | Disability | FAERS: 1 | US FAERS | |
| 17 | Dizziness | FAERS: 1 | US FAERS | |
| 18 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 19 | Drug ineffective | FAERS: 1 | US FAERS | |
| 20 | Dysgeusia | FAERS: 1 | US FAERS | |
| 21 | Dysuria | FAERS: 1 | US FAERS | |
| 22 | Erythema | FAERS: 1 | US FAERS | |
| 23 | Feeling Cold | FAERS: 1 | US FAERS | |
| 24 | Gingival Recession | FAERS: 1 | US FAERS | |
| 25 | Gout | FAERS: 1 | US FAERS | |
| 26 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 27 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 28 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 29 | Lethargy | FAERS: 1 | US FAERS | |
| 30 | Lymphoma | FAERS: 1 | US FAERS | |
| 31 | Malaise | FAERS: 1 | US FAERS | |
| 32 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 33 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 34 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 35 | Nausea | FAERS: 1 | US FAERS | |
| 36 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 37 | Pruritus | FAERS: 1 | US FAERS | |
| 38 | Secretion discharge | FAERS: 1 | US FAERS | |
| 39 | Somnolence | FAERS: 1 | US FAERS | |
| 40 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 41 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 42 | Wheelchair user | FAERS: 1 | US FAERS | |
| 43 | furuncle | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.