Lunelle
(NEDJKVIUOSOCNB-AWPSVMBFSA-N)
Structure
- SMILES
- O=C(O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O)CCC1CCCC1.O=C1CC[C@]2(C(=C1)[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)C
- Molecular Formula:
- C50H70O7
- Molecular Weight:
- 783.087
- Log P:
- 10.7857
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 106.97
- CAS Number(s):
- 71615-27-5
Synonym(s)
1.
Lunelle
2.
MPA-E2C
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 2 | Asthenia | FAERS: 1 | US FAERS | |
| 3 | Back Pain | FAERS: 1 | US FAERS | |
| 4 | Burning sensation | FAERS: 1 | US FAERS | |
| 5 | Candidiasis | FAERS: 1 | US FAERS | |
| 6 | Crying | FAERS: 1 | US FAERS | |
| 7 | Dizziness | FAERS: 1 | US FAERS | |
| 8 | Dyspareunia | FAERS: 1 | US FAERS | |
| 9 | Fatigue | FAERS: 1 | US FAERS | |
| 10 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 11 | Flatulence | FAERS: 1 | US FAERS | |
| 12 | Headache | FAERS: 1 | US FAERS | |
| 13 | Neck Pain | FAERS: 1 | US FAERS | |
| 14 | Nocturia | FAERS: 1 | US FAERS | |
| 15 | Pain | FAERS: 1 | US FAERS | |
| 16 | Pruritus | FAERS: 1 | US FAERS | |
| 17 | Secretion discharge | FAERS: 1 | US FAERS | |
| 18 | Somnolence | FAERS: 1 | US FAERS | |
| 19 | Vaginal pain | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.