Dotatate lutenium Lu-177
(MXDPZUIOZWKRAA-PRDSJKGBSA-K)
Structure
- SMILES
- NCCCC[C@@H]1NC(=O)[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC1=O)[C@H](O)C)C(=O)N[C@H](C(=O)O)[C@H](O)C)NC(=O)[C@@H](Cc1ccccc1)NC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-])Cc1c[nH]c2c1cccc2.[177Lu+3]
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C65H87LuN14O19S2
- Molecular Weight:
- 1609.540
- Log P:
- -4.1101
- Hydrogen Bond Acceptor:
- 34
- Hydrogen Bond Donor:
- 14
- TPSA:
- 556.55
- CAS Number(s):
- 437608-50-9
Synonym(s)
1.
Dotatate lutenium Lu-177
2.
2-[4-[2-[[(2R)-1-[[(4R,7S,10S,13R,16S,19R)-10-(4-Aminobutyl)-4-[[(1S,2R)-1-carboxy-2-hydroxypropyl]carbamoyl]-7-[(1R)-1-hydroxyethyl]-16-[(4-hydroxyphenyl)methyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicos-19-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]-7,10-bis(carboxylatomethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;lutetium-177(3+)
3.
Lutathera
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 3 | US FAERS | |
| 2 | Prothrombin time ratio decreased | FAERS: 3 | US FAERS | |
| 3 | Ascites | FAERS: 2 | US FAERS | |
| 4 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 5 | Vomiting | FAERS: 2 | US FAERS | |
| 6 | Alopecia | FAERS: 1 | US FAERS | |
| 7 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 8 | Back Pain | FAERS: 1 | US FAERS | |
| 9 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 10 | Bone pain | FAERS: 1 | US FAERS | |
| 11 | Constipation | FAERS: 1 | US FAERS | |
| 12 | Disease Progression | FAERS: 1 | US FAERS | |
| 13 | Fatigue | FAERS: 1 | US FAERS | |
| 14 | Flushing | FAERS: 1 | US FAERS | |
| 15 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 16 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 17 | Skin reaction | FAERS: 1 | US FAERS | |
| 18 | T-Cell Lymphoma | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120264
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.