Mebrofenin
(MHPZZZZLAQGTHT-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CN(CC(=O)Nc1c(C)cc(c(c1C)Br)C)CC(=O)O
- Molecular Formula:
- C15H19BrN2O5
- Molecular Weight:
- 387.226
- Log P:
- 1.8570
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 106.94
- CAS Number(s):
- 78266-06-5
Synonym(s)
1.
Mebrofenin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 2 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 3 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 4 | Chills | FAERS: 2 | SIDER US FAERS | |
| 5 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 6 | Nausea | FAERS: 2 | SIDER US FAERS | |
| 7 | Pain | FAERS: 2 | US FAERS | |
| 8 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 9 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 10 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 11 | Agitation | FAERS: 1 | US FAERS | |
| 12 | Alopecia | FAERS: 1 | US FAERS | |
| 13 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 14 | Dizziness | FAERS: 1 | US FAERS | |
| 15 | Drug ineffective | FAERS: 1 | US FAERS | |
| 16 | Feeling Cold | FAERS: 1 | US FAERS | |
| 17 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 18 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 19 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 20 | Tremor | FAERS: 1 | US FAERS | |
| 21 | Vomiting | FAERS: 1 | US FAERS | |
| 22 | Wheezing | FAERS: 1 | US FAERS | |
| 23 | Dermatitis | SIDER | ||
| 24 | Urticaria | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.