Xartemis XR
(LPIDDOOVLLQTPE-PCHTVJFHSA-N)
Structure
- SMILES
- CC(=O)Nc1ccc(cc1)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@]4(O)CCC1=O)C.Cl
- Molecular Formula:
- C26H31ClN2O6
- Molecular Weight:
- 502.987
- Log P:
- 3.2117
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 108.33
- CAS Number(s):
- 731850-86-5
Synonym(s)
1.
Xartemis XR
External Link(s)
| PubChem Compound | 6321309 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | nervous system disorder | FAERS: 4 | US FAERS | |
| 2 | Abasia | FAERS: 2 | US FAERS | |
| 3 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 4 | Burning sensation | FAERS: 2 | US FAERS | |
| 5 | Constipation | FAERS: 2 | US FAERS | |
| 6 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 7 | Extra dose administered | FAERS: 2 | US FAERS | |
| 8 | Eye irritation | FAERS: 2 | US FAERS | |
| 9 | Hostility | FAERS: 2 | US FAERS | |
| 10 | Medication residue present | FAERS: 2 | US FAERS | |
| 11 | Myalgia | FAERS: 2 | US FAERS | |
| 12 | Pain | FAERS: 2 | US FAERS | |
| 13 | Pruritus | FAERS: 2 | US FAERS | |
| 14 | Asthenia | FAERS: 1 | US FAERS | |
| 15 | Dehydration | FAERS: 1 | US FAERS | |
| 16 | Drug ineffective | FAERS: 1 | US FAERS | |
| 17 | Erythema | FAERS: 1 | US FAERS | |
| 18 | Nausea | FAERS: 1 | US FAERS | |
| 19 | Product use issue | FAERS: 1 | US FAERS | |
| 20 | Vomiting | FAERS: 1 | US FAERS | |
| 21 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 22 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.