Latanoprostene BUNOD
(LOVMMUBRQUFEAH-UIEAZXIASA-N)
Structure
- SMILES
- O[C@@H](CCc1ccccc1)CC[C@H]1[C@H](O)C[C@@H]([C@@H]1C/C=C\CCCC(=O)OCCCCO[N+](=O)[O-])O
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C27H41NO8
- Molecular Weight:
- 507.616
- Log P:
- 4.2897
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 142.04
- CAS Number(s):
- 860005-21-6
Synonym(s)
1.
Latanoprostene BUNOD
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye pain | FAERS: 11 | US FAERS | |
| 2 | Drug ineffective | FAERS: 8 | US FAERS | |
| 3 | Eye irritation | FAERS: 8 | US FAERS | |
| 4 | Pain | FAERS: 7 | US FAERS | |
| 5 | Dizziness | FAERS: 5 | US FAERS | |
| 6 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 7 | Burning sensation | FAERS: 3 | US FAERS | |
| 8 | Visual Impairment | FAERS: 3 | US FAERS | |
| 9 | Erythema | FAERS: 2 | US FAERS | |
| 10 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 11 | Headache | FAERS: 2 | US FAERS | |
| 12 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 13 | Nausea | FAERS: 2 | US FAERS | |
| 14 | Vomiting | FAERS: 2 | US FAERS | |
| 15 | Application site pain | FAERS: 1 | US FAERS | |
| 16 | Blepharitis | FAERS: 1 | US FAERS | |
| 17 | Cataract | FAERS: 1 | US FAERS | |
| 18 | Chest discomfort | FAERS: 1 | US FAERS | |
| 19 | Depressed mood | FAERS: 1 | US FAERS | |
| 20 | Diplopia | FAERS: 1 | US FAERS | |
| 21 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 22 | Epistaxis | FAERS: 1 | US FAERS | |
| 23 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 25 | Glaucoma | FAERS: 1 | US FAERS | |
| 26 | Impaired work ability | FAERS: 1 | US FAERS | |
| 27 | Iritis | FAERS: 1 | US FAERS | |
| 28 | Keratitis | FAERS: 1 | US FAERS | |
| 29 | Malaise | FAERS: 1 | US FAERS | |
| 30 | Photophobia | FAERS: 1 | US FAERS | |
| 31 | Product dose omission | FAERS: 1 | US FAERS | |
| 32 | Product storage error | FAERS: 1 | US FAERS | |
| 33 | Product substitution issue | FAERS: 1 | US FAERS | |
| 34 | Pruritus | FAERS: 1 | US FAERS | |
| 35 | Retirement | FAERS: 1 | US FAERS | |
| 36 | Somnolence | FAERS: 1 | US FAERS | |
| 37 | Splinter | FAERS: 1 | US FAERS | |
| 38 | Throat irritation | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.