Oseni
(LNTORSITGSWVNQ-DYYGGQLPSA-N)
Structure
- SMILES
- N#Cc1ccccc1Cn1c(cc(=O)n(c1=O)C)N1CCC[C@H](C1)N.CCc1ccc(nc1)CCOc1ccc(cc1)CC1SC(=O)NC1=O
- Molecular Formula:
- C37H41N7O5S
- Molecular Weight:
- 695.830
- Log P:
- 4.6482
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 2
- TPSA:
- 190.64
- CAS Number(s):
- N/A
Synonym(s)
1.
Oseni
External Link(s)
| PubChem Compound | 24764414 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 6 | US FAERS | |
| 2 | Pancreatitis | FAERS: 5 | US FAERS | |
| 3 | Urticaria | FAERS: 4 | US FAERS | |
| 4 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 5 | Chest Pain | FAERS: 3 | US FAERS | |
| 6 | Drug ineffective | FAERS: 3 | US FAERS | |
| 7 | Hunger | FAERS: 3 | US FAERS | |
| 8 | Nausea | FAERS: 3 | US FAERS | |
| 9 | No adverse event | FAERS: 3 | US FAERS | |
| 10 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 11 | Swelling | FAERS: 3 | US FAERS | |
| 12 | Arthralgia | FAERS: 2 | US FAERS | |
| 13 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 14 | Bursitis | FAERS: 2 | US FAERS | |
| 15 | Dysgeusia | FAERS: 2 | US FAERS | |
| 16 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 17 | Lip swelling | FAERS: 2 | US FAERS | |
| 18 | Pericarditis | FAERS: 2 | US FAERS | |
| 19 | Renal pain | FAERS: 2 | US FAERS | |
| 20 | Unevaluable event | FAERS: 2 | US FAERS | |
| 21 | Vomiting | FAERS: 2 | US FAERS | |
| 22 | Adverse event | FAERS: 1 | US FAERS | |
| 23 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 24 | Anxiety | FAERS: 1 | US FAERS | |
| 25 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 26 | Asthenia | FAERS: 1 | US FAERS | |
| 27 | Asthma | FAERS: 1 | US FAERS | |
| 28 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 29 | Dizziness | FAERS: 1 | US FAERS | |
| 30 | Dyspepsia | FAERS: 1 | US FAERS | |
| 31 | Fatigue | FAERS: 1 | US FAERS | |
| 32 | Lipase increased | FAERS: 1 | US FAERS | |
| 33 | Myalgia | FAERS: 1 | US FAERS | |
| 34 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 35 | Pain | FAERS: 1 | US FAERS | |
| 36 | Product physical issue | FAERS: 1 | US FAERS | |
| 37 | Product use issue | FAERS: 1 | US FAERS | |
| 38 | Pruritus | FAERS: 1 | US FAERS | |
| 39 | Urinary tract infection | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.