Campho-phenique
(LKTOWUZQHJSGAK-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1CC2C(C1(C)CC2)(C)C.Oc1ccccc1
- Molecular Formula:
- C16H22O2
- Molecular Weight:
- 246.345
- Log P:
- 3.7939
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 8002-06-0; 37262-59-2
Synonym(s)
1.
Campho-phenique
External Link(s)
| PubChem Compound | 197100 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Renal cyst | FAERS: 4 | US FAERS | |
| 2 | Burning sensation | FAERS: 2 | US FAERS | |
| 3 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 4 | Anorexia | FAERS: 1 | US FAERS | |
| 5 | Aphagia | FAERS: 1 | US FAERS | |
| 6 | Application site pain | FAERS: 1 | US FAERS | |
| 7 | Dyspepsia | FAERS: 1 | US FAERS | |
| 8 | Epistaxis | FAERS: 1 | US FAERS | |
| 9 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 10 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 11 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 12 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 13 | Stomatitis | FAERS: 1 | US FAERS | |
| 14 | Throat irritation | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.