Lamivudine/Zidovudine
(LHCOVOKZWQYODM-UHFFFAOYSA-N)
Structure
- SMILES
- Nc1ccn(c(=O)n1)C1CSC(O1)CO.OCC1OC(CC1N=[N+]=[N-])n1cc(C)c(=O)[nH]c1=O
- Molecular Formula:
- C18H24N8O7S
- Molecular Weight:
- 496.498
- Log P:
- -0.7564
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 249.74
- CAS Number(s):
- N/A
Synonym(s)
1.
Lamivudine/Zidovudine
External Link(s)
| PubChem Compound | 139030992 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Stillbirth | FAERS: 4 | US FAERS | |
| 2 | AIDS related complication | FAERS: 2 | US FAERS | |
| 3 | Dyspepsia | FAERS: 2 | US FAERS | |
| 4 | Fatigue | FAERS: 2 | US FAERS | |
| 5 | Nausea | FAERS: 2 | US FAERS | |
| 6 | Product substitution issue | FAERS: 2 | US FAERS | |
| 7 | Abscess | FAERS: 1 | US FAERS | |
| 8 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 9 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 10 | Arthralgia | FAERS: 1 | US FAERS | |
| 11 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 12 | Chest Pain | FAERS: 1 | US FAERS | |
| 13 | Completed Suicide | FAERS: 1 | US FAERS | |
| 14 | Dizziness | FAERS: 1 | US FAERS | |
| 15 | Eye pain | FAERS: 1 | US FAERS | |
| 16 | Headache | FAERS: 1 | US FAERS | |
| 17 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 18 | Joint swelling | FAERS: 1 | US FAERS | |
| 19 | Laceration | FAERS: 1 | US FAERS | |
| 20 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 21 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 22 | Myalgia | FAERS: 1 | US FAERS | |
| 23 | Narcolepsy | FAERS: 1 | US FAERS | |
| 24 | Nervousness | FAERS: 1 | US FAERS | |
| 25 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 26 | Thirst | FAERS: 1 | US FAERS | |
| 27 | Tremor | FAERS: 1 | US FAERS | |
| 28 | Troponin I increased | FAERS: 1 | US FAERS | |
| 29 | Ventricular hypokinesia | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.