N-carbamylglutamate
(LCQLHJZYVOQKHU-VKHMYHEASA-N)
Structure
- SMILES
- OC(=O)CC[C@@H](C(=O)O)NC(=O)N
- Type(s)
- Approved
- ATC code(s)
- A16AA05
- Molecular Formula:
- C6H10N2O5
- Molecular Weight:
- 190.154
- Log P:
- 0.0639
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 129.72
- CAS Number(s):
- 1188-38-1
Synonym(s)
1.
N-carbamylglutamate
2.
N-carbamoyl-L-glutamate
3.
N-carbamoylglutamate
4.
carbamylglutamate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Ammonia increased | FAERS: 30 | US FAERS | |
| 3 | Pancreatitis | FAERS: 10 | US FAERS | |
| 4 | Nasopharyngitis | FAERS: 9 | SIDER US FAERS | |
| 5 | Product dose omission | FAERS: 8 | US FAERS | |
| 6 | Nausea | FAERS: 7 | US FAERS | |
| 7 | Drug ineffective | FAERS: 5 | US FAERS | |
| 8 | Malaise | FAERS: 4 | US FAERS | |
| 9 | Acidosis | FAERS: 3 | US FAERS | |
| 10 | Constipation | FAERS: 3 | US FAERS | |
| 11 | Dehydration | FAERS: 3 | US FAERS | |
| 12 | Dysgeusia | FAERS: 3 | SIDER US FAERS | |
| 13 | Infection | FAERS: 3 | SIDER US FAERS | |
| 14 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 15 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 16 | Sepsis | FAERS: 3 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 2 | SIDER US FAERS | |
| 18 | Alopecia | FAERS: 2 | US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 20 | Disease Progression | FAERS: 2 | US FAERS | |
| 21 | Dizziness | FAERS: 2 | US FAERS | |
| 22 | Fatigue | FAERS: 2 | US FAERS | |
| 23 | Gastrostomy | FAERS: 2 | US FAERS | |
| 24 | Headache | FAERS: 2 | SIDER US FAERS | |
| 25 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 26 | Stoma site inflammation | FAERS: 2 | US FAERS | |
| 27 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 28 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 29 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 30 | Ammonia decreased | FAERS: 1 | US FAERS | |
| 31 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 32 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 33 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 34 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 35 | Crying | FAERS: 1 | US FAERS | |
| 36 | Device occlusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Disease complication | FAERS: 1 | US FAERS | |
| 38 | Drug dose omission | FAERS: 1 | US FAERS | |
| 39 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 40 | Flatulence | FAERS: 1 | US FAERS | |
| 41 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 42 | Gastric infection | FAERS: 1 | US FAERS | |
| 43 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 44 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 45 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 46 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 47 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 48 | Lethargy | FAERS: 1 | US FAERS | |
| 49 | Limb injury | FAERS: 1 | US FAERS | |
| 50 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 51 | Neutropenia | FAERS: 1 | US FAERS | |
| 52 | Perforation of great vessels | FAERS: 1 | US FAERS | |
| 53 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 54 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 55 | Protein urine present | FAERS: 1 | US FAERS | |
| 56 | Pruritus | FAERS: 1 | US FAERS | |
| 57 | Retching | FAERS: 1 | US FAERS | |
| 58 | Somnolence | FAERS: 1 | SIDER US FAERS | |
| 59 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 60 | Unevaluable event | FAERS: 1 | US FAERS | |
| 61 | Weight decreased | FAERS: 1 | SIDER US FAERS | |
| 62 | Anorexia | SIDER | ||
| 63 | Asthenia | SIDER | ||
| 64 | Blood and lymphatic system disorders | SIDER | ||
| 65 | Bradycardia | SIDER | ||
| 66 | Dermatitis | SIDER | ||
| 67 | Ear and labyrinth disorders | SIDER | ||
| 68 | Embryo Loss | 31369747 | CTD | |
| 69 | Gastrointestinal Pain | SIDER | ||
| 70 | Infestation | SIDER | ||
| 71 | Malnutrition | SIDER | ||
| 72 | Tonsillitis | SIDER | ||
| 73 | Transaminases increased | SIDER | ||
| 74 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.