Mayzent
(KIHYPELVXPAIDH-APTWKGOFSA-N)
Structure
- SMILES
- CCc1cc(ccc1CN1CC(C1)C(=O)O)/C(=N\OCc1ccc(c(c1)C(F)(F)F)C1CCCCC1)/C
- Molecular Formula:
- C29H35F3N2O3
- Molecular Weight:
- 516.595
- Log P:
- 6.7106
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 62.13
- CAS Number(s):
- N/A
Synonym(s)
1.
Mayzent
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Multiple sclerosis relapse | FAERS: 14 | US FAERS | |
| 2 | Headache | FAERS: 7 | US FAERS | |
| 3 | Fatigue | FAERS: 4 | US FAERS | |
| 4 | General physical condition decreased | FAERS: 4 | US FAERS | |
| 5 | Pain | FAERS: 4 | US FAERS | |
| 6 | Dizziness | FAERS: 3 | US FAERS | |
| 7 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 8 | Chills | FAERS: 2 | US FAERS | |
| 9 | Malaise | FAERS: 2 | US FAERS | |
| 10 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 11 | Somnolence | FAERS: 2 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 13 | Acne | FAERS: 1 | US FAERS | |
| 14 | Dyspepsia | FAERS: 1 | US FAERS | |
| 15 | Eye pain | FAERS: 1 | US FAERS | |
| 16 | Joint swelling | FAERS: 1 | US FAERS | |
| 17 | Limb discomfort | FAERS: 1 | US FAERS | |
| 18 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 19 | Nausea | FAERS: 1 | US FAERS | |
| 20 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 21 | Night sweats | FAERS: 1 | US FAERS | |
| 22 | Product packaging issue | FAERS: 1 | US FAERS | |
| 23 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 24 | Pruritus | FAERS: 1 | US FAERS | |
| 25 | Urticaria | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.