Actonel with calcium (copackaged)
(JUGHHWCHSPETNW-UHFFFAOYSA-L)
Structure
- SMILES
- OP(=O)(C(P(=O)(O)O)(Cc1cccnc1)O)O.[O-]C(=O)[O-].[Ca+2]
- Molecular Formula:
- C8H11CaNO10P2
- Molecular Weight:
- 383.199
- Log P:
- -2.8214
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 230.99
- CAS Number(s):
- N/A
Synonym(s)
1.
Actonel with calcium (copackaged)
External Link(s)
| PubChem Compound | 24847992 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 1 | US FAERS | |
| 2 | Asthenia | FAERS: 1 | US FAERS | |
| 3 | Bone pain | FAERS: 1 | US FAERS | |
| 4 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 5 | Dissociation | FAERS: 1 | US FAERS | |
| 6 | Dizziness | FAERS: 1 | US FAERS | |
| 7 | Eye pain | FAERS: 1 | US FAERS | |
| 8 | Fatigue | FAERS: 1 | US FAERS | |
| 9 | Headache | FAERS: 1 | US FAERS | |
| 10 | Macular degeneration | FAERS: 1 | US FAERS | |
| 11 | Memory impairment | FAERS: 1 | US FAERS | |
| 12 | Myalgia | FAERS: 1 | US FAERS | |
| 13 | Pain | FAERS: 1 | US FAERS | |
| 14 | Syncope | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.