Clarinex-D 12 Hour
(JQLKIIMCOASHLM-PXRPMCEGSA-N)
Structure
- SMILES
- Clc1ccc2c(c1)CCc1c(C2=C2CCNCC2)nccc1.CN[C@H]([C@H](c1ccccc1)O)C
- Molecular Formula:
- C29H34ClN3O
- Molecular Weight:
- 476.053
- Log P:
- 6.0665
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 57.18
- CAS Number(s):
- 855790-99-7
Synonym(s)
1.
Clarinex-D 12 Hour
External Link(s)
| PubChem Compound | 9891141 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 3 | US FAERS | |
| 2 | Malaise | FAERS: 2 | US FAERS | |
| 3 | Tachycardia | FAERS: 2 | US FAERS | |
| 4 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 5 | Chest Pain | FAERS: 1 | US FAERS | |
| 6 | Chills | FAERS: 1 | US FAERS | |
| 7 | Dizziness | FAERS: 1 | US FAERS | |
| 8 | Drug ineffective | FAERS: 1 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 11 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 12 | Lip swelling | FAERS: 1 | US FAERS | |
| 13 | Palpitations | FAERS: 1 | US FAERS | |
| 14 | Pruritus | FAERS: 1 | US FAERS | |
| 15 | Swelling | FAERS: 1 | US FAERS | |
| 16 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 17 | Tremor | FAERS: 1 | US FAERS | |
| 18 | Urinary Retention | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.