Indomethacin sodium
(JMHRGKDWGWORNU-UHFFFAOYSA-M)
Structure
- SMILES
- COc1ccc2c(c1)c(CC(=O)[O-])c(n2C(=O)c1ccc(cc1)Cl)C.[Na+]
- Molecular Formula:
- C19H15ClNNaO4
- Molecular Weight:
- 379.769
- Log P:
- 2.5926
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 71.36
- CAS Number(s):
- 7681-54-1
Synonym(s)
1.
Indomethacin sodium
External Link(s)
| PubChem Compound | 23675763 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 35 | US FAERS | |
| 2 | Neonatal disorder | FAERS: 22 | US FAERS | |
| 3 | Intestinal Perforation | FAERS: 21 | US FAERS | |
| 4 | Bacterial sepsis | FAERS: 6 | US FAERS | |
| 5 | Gastrointestinal perforation | FAERS: 6 | US FAERS | |
| 6 | Therapy non-responder | FAERS: 6 | US FAERS | |
| 7 | Oliguria | FAERS: 4 | US FAERS | |
| 8 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 9 | Blood urea increased | FAERS: 3 | US FAERS | |
| 10 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 11 | Sepsis | FAERS: 3 | US FAERS | |
| 12 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 13 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 14 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 15 | Neonatal cardiac failure | FAERS: 2 | US FAERS | |
| 16 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 17 | Peritoneal Dialysis | FAERS: 2 | US FAERS | |
| 18 | Pneumopericardium | FAERS: 2 | US FAERS | |
| 19 | Shock | FAERS: 2 | US FAERS | |
| 20 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 21 | Small Intestinal Stenosis | FAERS: 2 | US FAERS | |
| 22 | Acidosis | FAERS: 1 | US FAERS | |
| 23 | Agitation | FAERS: 1 | US FAERS | |
| 24 | Anuria | FAERS: 1 | US FAERS | |
| 25 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 26 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 27 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 28 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 29 | Flatulence | FAERS: 1 | US FAERS | |
| 30 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 31 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 32 | Myoclonus | FAERS: 1 | US FAERS | |
| 33 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 34 | Pneumothorax | FAERS: 1 | US FAERS | |
| 35 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 36 | Tremor | FAERS: 1 | US FAERS | |
| 37 | Vertigo | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.