Carvedilol phosphate
(JAYBFQXVKDGMFT-UHFFFAOYSA-N)
Structure
- SMILES
- OP(=O)(O)O.COc1ccccc1OCCNCC(COc1cccc2c1c1ccccc1[nH]2)O.O
- Molecular Formula:
- C24H31N2O9P
- Molecular Weight:
- 522.485
- Log P:
- 3.1360
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 7
- TPSA:
- 172.54
- CAS Number(s):
- 610309-89-2; 1196658-85-1
Synonym(s)
1.
Carvedilol phosphate
External Link(s)
| PubChem Compound | 23649704 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 11 | US FAERS | |
| 2 | Product substitution issue | FAERS: 8 | US FAERS | |
| 3 | Dizziness | FAERS: 5 | US FAERS | |
| 4 | Eructation | FAERS: 4 | US FAERS | |
| 5 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 6 | Adverse event | FAERS: 1 | US FAERS | |
| 7 | Amnesia | FAERS: 1 | US FAERS | |
| 8 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 9 | Asthenia | FAERS: 1 | US FAERS | |
| 10 | Drug dose omission | FAERS: 1 | US FAERS | |
| 11 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 12 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 13 | Emergency Care | FAERS: 1 | US FAERS | |
| 14 | Fatigue | FAERS: 1 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 16 | Headache | FAERS: 1 | US FAERS | |
| 17 | Hernia | FAERS: 1 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 19 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 20 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 21 | Malaise | FAERS: 1 | US FAERS | |
| 22 | Memory impairment | FAERS: 1 | US FAERS | |
| 23 | Nausea | FAERS: 1 | US FAERS | |
| 24 | Pain | FAERS: 1 | US FAERS | |
| 25 | Pregnancy test positive | FAERS: 1 | US FAERS | |
| 26 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 27 | Pruritus | FAERS: 1 | US FAERS | |
| 28 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.