Carbidopa-levodopa
(IVTMXOXVAHXCHI-ZCMDIHMWSA-N)
Structure
- SMILES
- OC(=O)[C@H](Cc1ccc(c(c1)O)O)N.NNC(C(=O)O)(Cc1ccc(c(c1)O)O)C
- Molecular Formula:
- C19H25N3O8
- Molecular Weight:
- 423.417
- Log P:
- 1.7906
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 9
- TPSA:
- 219.59
- CAS Number(s):
- 57308-51-7
Synonym(s)
1.
Carbidopa-levodopa
External Link(s)
| PubChem Compound | 441193 |
| ChEBI | 3396 |
| KEGG | cpd:C06870 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ataxia | FAERS: 2 | US FAERS | |
| 2 | Nerve Degeneration | FAERS: 2 | US FAERS | |
| 3 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 4 | Burning sensation | FAERS: 1 | US FAERS | |
| 5 | Demyelination | FAERS: 1 | US FAERS | |
| 6 | Drug Dependence | FAERS: 1 | US FAERS | |
| 7 | Headache | FAERS: 1 | US FAERS | |
| 8 | Hypomania | FAERS: 1 | US FAERS | |
| 9 | Pain | FAERS: 1 | US FAERS | |
| 10 | Product quality issue | FAERS: 1 | US FAERS | |
| 11 | Product substitution issue | FAERS: 1 | US FAERS | |
| 12 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 13 | Syncope | FAERS: 1 | US FAERS | |
| 14 | Tremor | FAERS: 1 | US FAERS | |
| 15 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.