Crystamine
(ILZDURAAGGSKOQ-WZHZPDAFSA-L)
Structure
- SMILES
- OC[C@H]1O[C@@H]([C@@H]([C@@H]1OP(=O)(O[C@@H](CNC(=O)CC[C@@]1(C)/C/2=C(\C)/C3=N/C(=C\C4=N/C(=C(\C5=N[C@]([C@@H]([C@@H]1CC(=O)N)[N-]2)(C)[C@@](C)(CC(=O)N)[C@@H]5CCC(=O)N)/C)/[C@@]([C@@H]4CCC(=O)N)(C)CC(=O)N)/C([C@@H]3CCC(=O)N)(C)C)C)[O-])O)n1cnc2c1cc(C)c(c2)C.[C-]#N.[Co]
- Molecular Formula:
- C63H88CoN14O14P---
- Molecular Weight:
- 1355.370
- Log P:
- 6.7119
- Hydrogen Bond Acceptor:
- 27
- Hydrogen Bond Donor:
- 9
- TPSA:
- 484.42
- CAS Number(s):
- 68-19-9
Synonym(s)
1.
Crystamine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anxiety | FAERS: 1 | US FAERS | |
| 2 | Application site mass | FAERS: 1 | US FAERS | |
| 3 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 4 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 5 | Chest discomfort | FAERS: 1 | US FAERS | |
| 6 | Flushing | FAERS: 1 | US FAERS | |
| 7 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 8 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 9 | Lethargy | FAERS: 1 | US FAERS | |
| 10 | Malaise | FAERS: 1 | US FAERS | |
| 11 | Myalgia | FAERS: 1 | US FAERS | |
| 12 | Nausea | FAERS: 1 | US FAERS | |
| 13 | Neck Pain | FAERS: 1 | US FAERS | |
| 14 | Presyncope | FAERS: 1 | US FAERS | |
| 15 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.