Hyoscyamine
(HOBWAPHTEJGALG-LFQBMQRVSA-N)
Structure
- SMILES
- OS(=O)(=O)O.OC[C@H](c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)N2C.OC[C@H](c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)N2C
- Molecular Formula:
- C34H48N2O10S
- Molecular Weight:
- 676.817
- Log P:
- 4.1656
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 182.52
- CAS Number(s):
- 620-61-1; 6835-16-1
Synonym(s)
1.
Hyoscyamine
2.
Atropine Sulfate, 3(S)-endo-Isomer
3.
Hyoscyamine Sulfate
4.
Anaspaz
5.
Atropine, 3(S)-endo-Isomer
6.
Cytospaz
7.
Hyoscyamine Hydrobromide
8.
Hyoscyamine Hydrochloride
9.
Hyoscyamine Sulfate Anhydrous
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 9 | US FAERS | |
| 2 | Anxiety | FAERS: 4 | US FAERS | |
| 3 | Product use issue | FAERS: 4 | US FAERS | |
| 4 | Medication Error | FAERS: 3 | US FAERS | |
| 5 | Chest discomfort | FAERS: 2 | US FAERS | |
| 6 | Disorientation | FAERS: 2 | US FAERS | |
| 7 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 8 | Dysphonia | FAERS: 2 | US FAERS | |
| 9 | Fatigue | FAERS: 2 | US FAERS | |
| 10 | Headache | FAERS: 2 | US FAERS | |
| 11 | Malaise | FAERS: 2 | US FAERS | |
| 12 | Memory impairment | FAERS: 2 | US FAERS | |
| 13 | Mouth swelling | FAERS: 2 | US FAERS | |
| 14 | Nausea | FAERS: 2 | US FAERS | |
| 15 | Overdose | FAERS: 2 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 17 | Accidental overdose | FAERS: 1 | US FAERS | |
| 18 | Bladder pain | FAERS: 1 | US FAERS | |
| 19 | Blindness | FAERS: 1 | US FAERS | |
| 20 | Burning sensation | FAERS: 1 | US FAERS | |
| 21 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 22 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 23 | Conversion disorder | FAERS: 1 | US FAERS | |
| 24 | Crying | FAERS: 1 | US FAERS | |
| 25 | Dehydration | FAERS: 1 | US FAERS | |
| 26 | Drug ineffective | FAERS: 1 | US FAERS | |
| 27 | Dry skin | FAERS: 1 | US FAERS | |
| 28 | Embolism | FAERS: 1 | US FAERS | |
| 29 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 31 | Glaucoma | FAERS: 1 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 33 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 34 | Initial insomnia | FAERS: 1 | US FAERS | |
| 35 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 36 | Medication residue | FAERS: 1 | US FAERS | |
| 37 | Mydriasis | FAERS: 1 | US FAERS | |
| 38 | Nervousness | FAERS: 1 | US FAERS | |
| 39 | Nocturia | FAERS: 1 | US FAERS | |
| 40 | Ocular icterus | FAERS: 1 | US FAERS | |
| 41 | Pain of skin | FAERS: 1 | US FAERS | |
| 42 | Palpitations | FAERS: 1 | US FAERS | |
| 43 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 44 | Product contamination physical | FAERS: 1 | US FAERS | |
| 45 | Product quality issue | FAERS: 1 | US FAERS | |
| 46 | Product substitution issue | FAERS: 1 | US FAERS | |
| 47 | Pruritus | FAERS: 1 | US FAERS | |
| 48 | Retching | FAERS: 1 | US FAERS | |
| 49 | Somnolence | FAERS: 1 | US FAERS | |
| 50 | Thirst | FAERS: 1 | US FAERS | |
| 51 | Transcription medication error | FAERS: 1 | US FAERS | |
| 52 | Tremor | FAERS: 1 | US FAERS | |
| 53 | Urinary Retention | FAERS: 1 | US FAERS | |
| 54 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.