Fostamatinib
(GKDRMWXFWHEQQT-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc(Nc2ncc(c(n2)Nc2ccc3c(n2)N(COP(=O)(O)O)C(=O)C(O3)(C)C)F)cc(c1OC)OC
- Type(s)
- Approved; Investigational
- ATC code(s)
- B02BX09
- Molecular Formula:
- C23H26FN6O9P
- Molecular Weight:
- 580.460
- Log P:
- 3.3055
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 196.53
- CAS Number(s):
- 901119-35-5
Synonym(s)
1.
Fostamatinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Intentional product misuse | FAERS: 51 | US FAERS | |
| 2 | Drug ineffective | FAERS: 41 | US FAERS | |
| 3 | Product dose omission | FAERS: 33 | US FAERS | |
| 4 | Dizziness | FAERS: 13 | US FAERS | |
| 5 | Fatigue | FAERS: 11 | US FAERS | |
| 6 | Headache | FAERS: 11 | US FAERS | |
| 7 | Malaise | FAERS: 6 | US FAERS | |
| 8 | Anxiety | FAERS: 5 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 10 | Nausea | FAERS: 5 | US FAERS | |
| 11 | Pain | FAERS: 5 | US FAERS | |
| 12 | Product use issue | FAERS: 5 | US FAERS | |
| 13 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 14 | Chest Pain | FAERS: 4 | US FAERS | |
| 15 | Memory impairment | FAERS: 4 | US FAERS | |
| 16 | Pruritus | FAERS: 4 | US FAERS | |
| 17 | Adverse event | FAERS: 3 | US FAERS | |
| 18 | Disease Progression | FAERS: 3 | US FAERS | |
| 19 | Epistaxis | FAERS: 3 | US FAERS | |
| 20 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 21 | Neutropenia | FAERS: 3 | US FAERS | |
| 22 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 23 | Sinusitis | FAERS: 3 | US FAERS | |
| 24 | Tooth Infection | FAERS: 3 | US FAERS | |
| 25 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 26 | Weight decreased | FAERS: 3 | US FAERS | |
| 27 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 28 | Alopecia | FAERS: 2 | US FAERS | |
| 29 | Arthralgia | FAERS: 2 | US FAERS | |
| 30 | Diverticulitis | FAERS: 2 | US FAERS | |
| 31 | Flatulence | FAERS: 2 | US FAERS | |
| 32 | Impaired work ability | FAERS: 2 | US FAERS | |
| 33 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 34 | No adverse event | FAERS: 2 | US FAERS | |
| 35 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 36 | Petechiae | FAERS: 2 | US FAERS | |
| 37 | Pneumonia | FAERS: 2 | US FAERS | |
| 38 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 39 | Vomiting | FAERS: 2 | US FAERS | |
| 40 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 41 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 42 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 43 | Asthenia | FAERS: 1 | US FAERS | |
| 44 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 45 | Back Pain | FAERS: 1 | US FAERS | |
| 46 | Blood blister | FAERS: 1 | US FAERS | |
| 47 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 48 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 49 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 50 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 51 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 52 | Disorientation | FAERS: 1 | US FAERS | |
| 53 | Dysgeusia | FAERS: 1 | US FAERS | |
| 54 | Emotional disorder | FAERS: 1 | US FAERS | |
| 55 | Erythema | FAERS: 1 | US FAERS | |
| 56 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 57 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 58 | Head discomfort | FAERS: 1 | US FAERS | |
| 59 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 60 | Hospice Care | FAERS: 1 | US FAERS | |
| 61 | Infection | FAERS: 1 | US FAERS | |
| 62 | Influenza | FAERS: 1 | US FAERS | |
| 63 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 64 | Joint swelling | FAERS: 1 | US FAERS | |
| 65 | Limb injury | FAERS: 1 | US FAERS | |
| 66 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 67 | Myalgia | FAERS: 1 | US FAERS | |
| 68 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 69 | Myopathy | FAERS: 1 | US FAERS | |
| 70 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 71 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 72 | Product complaint | FAERS: 1 | US FAERS | |
| 73 | Product intolerance | FAERS: 1 | US FAERS | |
| 74 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 75 | Rash erythematous | FAERS: 1 | US FAERS | |
| 76 | Sepsis | FAERS: 1 | US FAERS | |
| 77 | Splenectomy | FAERS: 1 | US FAERS | |
| 78 | Stress | FAERS: 1 | US FAERS | |
| 79 | Swelling | FAERS: 1 | US FAERS | |
| 80 | Thirst | FAERS: 1 | US FAERS | |
| 81 | Tinnitus | FAERS: 1 | US FAERS | |
| 82 | Transplant | FAERS: 1 | US FAERS | |
| 83 | Tremor | FAERS: 1 | US FAERS | |
| 84 | Wheezing | FAERS: 1 | US FAERS | |
| 85 | White blood cell count abnormal | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.