Dymista
(GEVMVZWOOIIINI-KTIJLCEXSA-N)
Structure
- SMILES
- CN1CCCC(CC1)n1nc(Cc2ccc(cc2)Cl)c2c(c1=O)cccc2.FCSC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F.Cl
- Molecular Formula:
- C47H56Cl2F3N3O6S
- Molecular Weight:
- 918.930
- Log P:
- 9.4674
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 2
- TPSA:
- 144.1
- CAS Number(s):
- 1417803-89-4
Synonym(s)
1.
Dymista
External Link(s)
| PubChem Compound | 9897697 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dysgeusia | FAERS: 47 | US FAERS | |
| 2 | Headache | FAERS: 41 | US FAERS | |
| 3 | Epistaxis | FAERS: 37 | US FAERS | |
| 4 | Drug ineffective | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Somnolence | FAERS: 21 | US FAERS | |
| 6 | Product quality issue | FAERS: 20 | US FAERS | |
| 7 | Nasal discomfort | FAERS: 17 | US FAERS | |
| 8 | Nausea | FAERS: 17 | US FAERS | |
| 9 | Sneezing | FAERS: 16 | US FAERS | |
| 10 | Dizziness | FAERS: 15 | US FAERS | |
| 11 | Product use issue | FAERS: 11 | US FAERS | |
| 12 | Ageusia | FAERS: 10 | US FAERS | |
| 13 | Fatigue | FAERS: 10 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 15 | Anosmia | FAERS: 9 | US FAERS | |
| 16 | Erythema | FAERS: 9 | US FAERS | |
| 17 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 18 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 19 | Anxiety | FAERS: 8 | US FAERS | |
| 20 | Burning sensation | FAERS: 8 | US FAERS | |
| 21 | No adverse event | FAERS: 8 | US FAERS | |
| 22 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 23 | Asthenia | FAERS: 7 | US FAERS | |
| 24 | Dysphonia | FAERS: 7 | US FAERS | |
| 25 | Expired product administered | FAERS: 6 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 27 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 28 | Palpitations | FAERS: 6 | US FAERS | |
| 29 | Throat irritation | FAERS: 6 | US FAERS | |
| 30 | Vomiting | FAERS: 6 | US FAERS | |
| 31 | Eye irritation | FAERS: 5 | US FAERS | |
| 32 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 33 | Upper-airway cough syndrome | FAERS: 5 | US FAERS | |
| 34 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 35 | Arthralgia | FAERS: 4 | US FAERS | |
| 36 | Laceration | FAERS: 4 | US FAERS | |
| 37 | Malaise | FAERS: 4 | US FAERS | |
| 38 | Myalgia | FAERS: 4 | US FAERS | |
| 39 | Asthma | FAERS: 3 | US FAERS | |
| 40 | Bronchitis | FAERS: 3 | US FAERS | |
| 41 | Discomfort | FAERS: 3 | US FAERS | |
| 42 | Drug dose omission | FAERS: 3 | US FAERS | |
| 43 | Euphoric mood | FAERS: 3 | US FAERS | |
| 44 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 45 | Lip swelling | FAERS: 3 | US FAERS | |
| 46 | Nervousness | FAERS: 3 | US FAERS | |
| 47 | Pain | FAERS: 3 | US FAERS | |
| 48 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 49 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 50 | Retching | FAERS: 3 | US FAERS | |
| 51 | Rhinalgia | FAERS: 3 | US FAERS | |
| 52 | Swelling | FAERS: 3 | US FAERS | |
| 53 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 54 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 55 | Bronchospasm | FAERS: 2 | US FAERS | |
| 56 | Chest Pain | FAERS: 2 | US FAERS | |
| 57 | Choking sensation | FAERS: 2 | US FAERS | |
| 58 | Choking | FAERS: 2 | US FAERS | |
| 59 | Dehydration | FAERS: 2 | US FAERS | |
| 60 | Depressed mood | FAERS: 2 | US FAERS | |
| 61 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 62 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 63 | Dyspepsia | FAERS: 2 | US FAERS | |
| 64 | Extra dose administered | FAERS: 2 | US FAERS | |
| 65 | Flushing | FAERS: 2 | US FAERS | |
| 66 | Glaucoma | FAERS: 2 | US FAERS | |
| 67 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 68 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 69 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 70 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 71 | Pruritus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Rebound effect | FAERS: 2 | US FAERS | |
| 73 | Restlessness | FAERS: 2 | US FAERS | |
| 74 | Rhinitis | FAERS: 2 | US FAERS | |
| 75 | Scab | FAERS: 2 | US FAERS | |
| 76 | Sinusitis | FAERS: 2 | US FAERS | |
| 77 | Toothache | FAERS: 2 | US FAERS | |
| 78 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 79 | Agitation | FAERS: 1 | US FAERS | |
| 80 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 81 | Anger | FAERS: 1 | US FAERS | |
| 82 | Angioedema | FAERS: 1 | US FAERS | |
| 83 | Back Pain | FAERS: 1 | US FAERS | |
| 84 | Blepharitis | FAERS: 1 | US FAERS | |
| 85 | Blindness | FAERS: 1 | US FAERS | |
| 86 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 87 | Cataract | FAERS: 1 | US FAERS | |
| 88 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 89 | Chills | FAERS: 1 | US FAERS | |
| 90 | Constipation | FAERS: 1 | US FAERS | |
| 91 | Crying | FAERS: 1 | US FAERS | |
| 92 | Cystitis | FAERS: 1 | US FAERS | |
| 93 | Delirium | FAERS: 1 | US FAERS | |
| 94 | Device malfunction | FAERS: 1 | US FAERS | |
| 95 | Device related infection | FAERS: 1 | US FAERS | |
| 96 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 97 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 98 | Ear discomfort | FAERS: 1 | US FAERS | |
| 99 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 100 | Eructation | FAERS: 1 | US FAERS | |
| 101 | Eye operation complication | FAERS: 1 | US FAERS | |
| 102 | Eye pain | FAERS: 1 | US FAERS | |
| 103 | Facial paralysis | FAERS: 1 | US FAERS | |
| 104 | Fibrosis | FAERS: 1 | US FAERS | |
| 105 | Fixed eruption | FAERS: 1 | US FAERS | |
| 106 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 107 | Gastritis | FAERS: 1 | US FAERS | |
| 108 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 109 | Glossitis | FAERS: 1 | US FAERS | |
| 110 | Head discomfort | FAERS: 1 | US FAERS | |
| 111 | Hemiplegia | FAERS: 1 | US FAERS | |
| 112 | House dust allergy | FAERS: 1 | US FAERS | |
| 113 | Hypersomnia | FAERS: 1 | US FAERS | |
| 114 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 115 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 116 | Initial insomnia | FAERS: 1 | US FAERS | |
| 117 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 118 | Lethargy | FAERS: 1 | US FAERS | |
| 119 | Limb operation | FAERS: 1 | US FAERS | |
| 120 | Mental status changes | FAERS: 1 | US FAERS | |
| 121 | Middle insomnia | FAERS: 1 | US FAERS | |
| 122 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 123 | Mouth swelling | FAERS: 1 | US FAERS | |
| 124 | Mydriasis | FAERS: 1 | US FAERS | |
| 125 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 126 | Nasal mucosal ulcer | FAERS: 1 | US FAERS | |
| 127 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 128 | Nerve injury | FAERS: 1 | US FAERS | |
| 129 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 130 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 131 | Oral pain | FAERS: 1 | US FAERS | |
| 132 | Oral papule | FAERS: 1 | US FAERS | |
| 133 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 134 | Pain of skin | FAERS: 1 | US FAERS | |
| 135 | Pallor | FAERS: 1 | US FAERS | |
| 136 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 137 | Post procedural infection | FAERS: 1 | US FAERS | |
| 138 | Product packaging issue | FAERS: 1 | US FAERS | |
| 139 | Productive Cough | FAERS: 1 | US FAERS | |
| 140 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 141 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 142 | Rash erythematous | FAERS: 1 | US FAERS | |
| 143 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 144 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 145 | Saliva altered | FAERS: 1 | US FAERS | |
| 146 | Sense of oppression | FAERS: 1 | US FAERS | |
| 147 | Sinus headache | FAERS: 1 | US FAERS | |
| 148 | Sinus pain | FAERS: 1 | US FAERS | |
| 149 | Strabismus | FAERS: 1 | US FAERS | |
| 150 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 151 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 152 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 153 | Thirst | FAERS: 1 | US FAERS | |
| 154 | Tinnitus | FAERS: 1 | US FAERS | |
| 155 | Tremor | FAERS: 1 | US FAERS | |
| 156 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 157 | Urinary Retention | FAERS: 1 | US FAERS | |
| 158 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 159 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 160 | Urticaria | FAERS: 1 | US FAERS | |
| 161 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 162 | Vertigo | FAERS: 1 | US FAERS | |
| 163 | Visual Impairment | FAERS: 1 | US FAERS | |
| 164 | Weight decreased | FAERS: 1 | US FAERS | |
| 165 | Wheezing | FAERS: 1 | US FAERS | |
| 166 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 167 | furuncle | FAERS: 1 | US FAERS | |
| 168 | nervous system disorder | FAERS: 1 | US FAERS | |
| 169 | prostatitis | FAERS: 1 | US FAERS | |
| 170 | Miliaria | Canada Vigilance: 1 | Canada Vigilance | |
| 171 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.