Atenolol and chlorthalidone
(GEGCOFDJWXJACT-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1NC(c2c1cccc2)(O)c1ccc(c(c1)S(=O)(=O)N)Cl.OC(COc1ccc(cc1)CC(=O)N)CNC(C)C
- Molecular Formula:
- C28H33ClN4O7S
- Molecular Weight:
- 605.102
- Log P:
- 4.5774
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 6
- TPSA:
- 202.45
- CAS Number(s):
- 73677-19-7
Synonym(s)
1.
Atenolol and chlorthalidone
External Link(s)
| PubChem Compound | 173202 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 5 | US FAERS | |
| 3 | Bradycardia | FAERS: 4 | US FAERS | |
| 4 | Gout | FAERS: 3 | US FAERS | |
| 5 | Headache | FAERS: 3 | US FAERS | |
| 6 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 7 | Vomiting | FAERS: 3 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 9 | Dehydration | FAERS: 2 | US FAERS | |
| 10 | Dysgeusia | FAERS: 2 | US FAERS | |
| 11 | Nausea | FAERS: 2 | US FAERS | |
| 12 | Palpitations | FAERS: 2 | US FAERS | |
| 13 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 14 | Adverse event | FAERS: 1 | US FAERS | |
| 15 | Anxiety | FAERS: 1 | US FAERS | |
| 16 | Asthenia | FAERS: 1 | US FAERS | |
| 17 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 18 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 19 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 20 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 21 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 22 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 23 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 24 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 25 | Chest Pain | FAERS: 1 | US FAERS | |
| 26 | Cold sweat | FAERS: 1 | US FAERS | |
| 27 | Disorientation | FAERS: 1 | US FAERS | |
| 28 | Eosinophilia | FAERS: 1 | US FAERS | |
| 29 | Fatigue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 31 | Head discomfort | FAERS: 1 | US FAERS | |
| 32 | Infection | FAERS: 1 | US FAERS | |
| 33 | Medication Error | FAERS: 1 | US FAERS | |
| 34 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 35 | Overdose | FAERS: 1 | US FAERS | |
| 36 | Polyuria | FAERS: 1 | US FAERS | |
| 37 | Presyncope | FAERS: 1 | US FAERS | |
| 38 | Product quality issue | FAERS: 1 | US FAERS | |
| 39 | Product substitution issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Psoriasis | FAERS: 1 | US FAERS | |
| 41 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 42 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 43 | Somnolence | FAERS: 1 | US FAERS | |
| 44 | Syncope | FAERS: 1 | US FAERS | |
| 45 | Tachycardia | FAERS: 1 | US FAERS | |
| 46 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 47 | Tinnitus | FAERS: 1 | US FAERS | |
| 48 | Tremor | FAERS: 1 | US FAERS | |
| 49 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 50 | Visual Impairment | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.