Articaine hydrochloride
(GDWDBGSWGNEMGJ-UHFFFAOYSA-N)
Structure
- SMILES
- CCCNC(C(=O)Nc1c(C)csc1C(=O)OC)C.Cl
- Molecular Formula:
- C13H21ClN2O3S
- Molecular Weight:
- 320.835
- Log P:
- 3.4356
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 95.67
- CAS Number(s):
- 23964-57-0
Synonym(s)
1.
Articaine hydrochloride
2.
Hydron;methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate;chloride
External Link(s)
| PubChem Compound | 32169 46856326 |
| CHEMBL | CHEMBL1200819 |
| KEGG | dr:D02991 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malaise | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Erythema | FAERS: 3 | US FAERS | |
| 3 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 4 | Headache | FAERS: 3 | US FAERS | |
| 5 | Vomiting | FAERS: 3 | US FAERS | |
| 6 | Dizziness | FAERS: 2 | US FAERS | |
| 7 | Facial Pain | FAERS: 2 | US FAERS | |
| 8 | Hemiplegia | FAERS: 2 | US FAERS | |
| 9 | Pain | FAERS: 2 | US FAERS | |
| 10 | Reversible cerebral vasoconstriction syndrome | FAERS: 2 | US FAERS | |
| 11 | Somnolence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 13 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 14 | Agitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Anxiety | FAERS: 1 | US FAERS | |
| 16 | Blindness | FAERS: 1 | US FAERS | |
| 17 | Bradycardia | FAERS: 1 | US FAERS | |
| 18 | Burning sensation | FAERS: 1 | US FAERS | |
| 19 | Chest Pain | FAERS: 1 | US FAERS | |
| 20 | Device breakage | FAERS: 1 | US FAERS | |
| 21 | Discomfort | FAERS: 1 | US FAERS | |
| 22 | Disorientation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Dysgeusia | FAERS: 1 | US FAERS | |
| 24 | Dysphonia | FAERS: 1 | US FAERS | |
| 25 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 26 | Facial paralysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Fatigue | FAERS: 1 | US FAERS | |
| 28 | Gingival blister | FAERS: 1 | US FAERS | |
| 29 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 30 | Injection site erythema | FAERS: 1 | US FAERS | |
| 31 | Nausea | FAERS: 1 | US FAERS | |
| 32 | Nerve injury | FAERS: 1 | US FAERS | |
| 33 | Neuralgia | FAERS: 1 | US FAERS | |
| 34 | Oral pain | FAERS: 1 | US FAERS | |
| 35 | Pain of skin | FAERS: 1 | US FAERS | |
| 36 | Pallor | FAERS: 1 | US FAERS | |
| 37 | Restlessness | FAERS: 1 | US FAERS | |
| 38 | Sneezing | FAERS: 1 | US FAERS | |
| 39 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 40 | Tension Headache | FAERS: 1 | US FAERS | |
| 41 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 42 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 43 | Crying | Canada Vigilance: 1 | Canada Vigilance | |
| 44 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 45 | Hypersensitivity | Canada Vigilance: 1 | Canada Vigilance | |
| 46 | Ophthalmoplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 47 | Syncope | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.