Brontex
(DUOAHWFKQYKHEE-FFHNEAJVSA-N)
Structure
- SMILES
- COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4C=C[C@@H]1O)C.OCC(COc1ccccc1OC)O
- Molecular Formula:
- C28H35NO7
- Molecular Weight:
- 497.580
- Log P:
- 1.8662
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 100.85
- CAS Number(s):
- N/A
Synonym(s)
1.
Brontex
External Link(s)
| PubChem Compound | 16757528 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 2 | Malaise | FAERS: 3 | US FAERS | |
| 3 | Dizziness | FAERS: 2 | US FAERS | |
| 4 | Nausea | FAERS: 2 | US FAERS | |
| 5 | Vomiting | FAERS: 2 | US FAERS | |
| 6 | Accidental death | FAERS: 1 | US FAERS | |
| 7 | Accidental overdose | FAERS: 1 | US FAERS | |
| 8 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 9 | Drug ineffective | FAERS: 1 | US FAERS | |
| 10 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 11 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 12 | Headache | FAERS: 1 | US FAERS | |
| 13 | Hypersomnia | FAERS: 1 | US FAERS | |
| 14 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 15 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 16 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 17 | Product physical issue | FAERS: 1 | US FAERS | |
| 18 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 19 | Somnolence | FAERS: 1 | US FAERS | |
| 20 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 21 | Transcription medication error | FAERS: 1 | US FAERS | |
| 22 | Tremor | FAERS: 1 | US FAERS | |
| 23 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.