Listerine
(CSAVDNHVPJNKTC-UHFFFAOYSA-N)
Structure
- SMILES
- CC12CCC(CC1)C(O2)(C)C.Cc1ccc(c(c1)O)C(C)C.CC1CCC(C(C1)O)C(C)C
- Molecular Formula:
- C30H52O3
- Molecular Weight:
- 460.732
- Log P:
- 8.0076
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 49.69
- CAS Number(s):
- 51273-66-6
Synonym(s)
1.
Listerine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect route of drug administration | FAERS: 24 | US FAERS | |
| 2 | Intentional drug misuse | FAERS: 15 | US FAERS | |
| 3 | Drug abuse | FAERS: 11 | US FAERS | |
| 4 | Product quality issue | FAERS: 10 | US FAERS | |
| 5 | Ageusia | FAERS: 5 | US FAERS | |
| 6 | Application site burn | FAERS: 4 | US FAERS | |
| 7 | Oral pain | FAERS: 4 | US FAERS | |
| 8 | Accidental exposure | FAERS: 3 | US FAERS | |
| 9 | Amnesia | FAERS: 3 | US FAERS | |
| 10 | Chemical injury | FAERS: 3 | US FAERS | |
| 11 | Completed Suicide | FAERS: 3 | US FAERS | |
| 12 | Dysgeusia | FAERS: 3 | US FAERS | |
| 13 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 14 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 15 | Overdose | FAERS: 3 | US FAERS | |
| 16 | Product counterfeit | FAERS: 3 | US FAERS | |
| 17 | Toothache | FAERS: 3 | US FAERS | |
| 18 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 19 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 20 | Asthma | FAERS: 2 | US FAERS | |
| 21 | Breath alcohol test positive | FAERS: 2 | US FAERS | |
| 22 | Burning sensation | FAERS: 2 | US FAERS | |
| 23 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 24 | Dependence | FAERS: 2 | US FAERS | |
| 25 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 26 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 27 | Mucosal erosion | FAERS: 2 | US FAERS | |
| 28 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 29 | Pain | FAERS: 2 | US FAERS | |
| 30 | Stomatitis | FAERS: 2 | US FAERS | |
| 31 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 32 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 33 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 34 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 35 | Alcohol problem | FAERS: 1 | US FAERS | |
| 36 | Angioedema | FAERS: 1 | US FAERS | |
| 37 | Aphonia | FAERS: 1 | US FAERS | |
| 38 | Application site erythema | FAERS: 1 | US FAERS | |
| 39 | Application site swelling | FAERS: 1 | US FAERS | |
| 40 | Application site vesicles | FAERS: 1 | US FAERS | |
| 41 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 42 | Caustic injury | FAERS: 1 | US FAERS | |
| 43 | Device Failure | FAERS: 1 | US FAERS | |
| 44 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 45 | Drug Dependence | FAERS: 1 | US FAERS | |
| 46 | Drug toxicity | FAERS: 1 | US FAERS | |
| 47 | Emotional disorder | FAERS: 1 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 49 | Food Allergy | FAERS: 1 | US FAERS | |
| 50 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 51 | Headache | FAERS: 1 | US FAERS | |
| 52 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 53 | Measles | FAERS: 1 | US FAERS | |
| 54 | Nodule | FAERS: 1 | US FAERS | |
| 55 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 56 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 57 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 58 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 59 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 60 | Skin laceration | FAERS: 1 | US FAERS | |
| 61 | Suicide attempt | FAERS: 1 | US FAERS | |
| 62 | Syncope | FAERS: 1 | US FAERS | |
| 63 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 64 | Thermal burn | FAERS: 1 | US FAERS | |
| 65 | Tremor | FAERS: 1 | US FAERS | |
| 66 | Vomiting | FAERS: 1 | US FAERS | |
| 67 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.