olodaterol
(COUYJEVMBVSIHV-SFHVURJKSA-N)
Structure
- SMILES
- COc1ccc(cc1)CC(NC[C@@H](c1cc(O)cc2c1OCC(=O)N2)O)(C)C
- Type(s)
- Approved
- ATC code(s)
- R03AC19; R03AL06
- Molecular Formula:
- C21H26N2O5
- Molecular Weight:
- 386.442
- Log P:
- 2.9049
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 100.05
- CAS Number(s):
- 868049-49-4
Synonym(s)
1.
olodaterol
2.
6-hydroxy-8-(1-hydroxy-2-((2-(4-methoxyphenyl)-1,1-dimethylethyl)amino)ethyl)-2H-1,4-benzoxazin-3(4H)-one
3.
BI 1744 CL
4.
BI-1744 CL
5.
Striverdi Respimat
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 5 | US FAERS | |
| 2 | Headache | FAERS: 5 | US FAERS | |
| 3 | Asthenia | FAERS: 4 | US FAERS | |
| 4 | Dizziness | FAERS: 4 | SIDER US FAERS | |
| 5 | Chest Pain | FAERS: 3 | US FAERS | |
| 6 | Tremor | FAERS: 3 | US FAERS | |
| 7 | Anxiety | FAERS: 2 | US FAERS | |
| 8 | Asthma | FAERS: 2 | US FAERS | |
| 9 | Fatigue | FAERS: 2 | US FAERS | |
| 10 | Joint swelling | FAERS: 2 | US FAERS | |
| 11 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 12 | Palpitations | FAERS: 2 | US FAERS | |
| 13 | Throat irritation | FAERS: 2 | US FAERS | |
| 14 | Unevaluable event | FAERS: 2 | US FAERS | |
| 15 | Wheezing | FAERS: 2 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 17 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 18 | Adverse event | FAERS: 1 | US FAERS | |
| 19 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 20 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 22 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 23 | Bladder pain | FAERS: 1 | US FAERS | |
| 24 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 25 | Burning sensation | FAERS: 1 | US FAERS | |
| 26 | Choking | FAERS: 1 | US FAERS | |
| 27 | Deafness | FAERS: 1 | US FAERS | |
| 28 | Dental caries | FAERS: 1 | US FAERS | |
| 29 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 30 | Discomfort | FAERS: 1 | US FAERS | |
| 31 | Dysphonia | FAERS: 1 | US FAERS | |
| 32 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 33 | Head discomfort | FAERS: 1 | US FAERS | |
| 34 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 35 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 36 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 37 | Lip swelling | FAERS: 1 | US FAERS | |
| 38 | Medication Error | FAERS: 1 | US FAERS | |
| 39 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 40 | Myalgia | FAERS: 1 | US FAERS | |
| 41 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 42 | Nausea | FAERS: 1 | US FAERS | |
| 43 | Neck Pain | FAERS: 1 | US FAERS | |
| 44 | Overdose | FAERS: 1 | US FAERS | |
| 45 | Peak expiratory flow rate | FAERS: 1 | US FAERS | |
| 46 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 47 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 48 | Product quality issue | FAERS: 1 | US FAERS | |
| 49 | Product substitution issue | FAERS: 1 | US FAERS | |
| 50 | Productive Cough | FAERS: 1 | US FAERS | |
| 51 | Rales | FAERS: 1 | US FAERS | |
| 52 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 53 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 54 | Secretion discharge | FAERS: 1 | US FAERS | |
| 55 | Stomatitis | FAERS: 1 | US FAERS | |
| 56 | Tachycardia | FAERS: 1 | US FAERS | |
| 57 | Therapy cessation | FAERS: 1 | US FAERS | |
| 58 | Therapy change | FAERS: 1 | US FAERS | |
| 59 | Urinary Retention | FAERS: 1 | US FAERS | |
| 60 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 61 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 62 | Vomiting | FAERS: 1 | US FAERS | |
| 63 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 64 | Back Pain | SIDER | ||
| 65 | COPD exacerbation | SIDER | ||
| 66 | Constipation | SIDER | ||
| 67 | Infection | SIDER | ||
| 68 | Infestation | SIDER | ||
| 69 | Musculoskeletal discomfort | SIDER | ||
| 70 | Pneumonia | SIDER | ||
| 71 | Urinary tract infection | SIDER | ||
| 72 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.