syntometrine
(CEDGTLOSFDBJKR-KVXRPJDVSA-N)
Structure
- SMILES
- OC(=O)/C=C\C(=O)O.CC[C@@H](C1NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)CCC(=O)N)CC(=O)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N)CC(C)C)C.OC[C@@H](NC(=O)[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)C
- Molecular Formula:
- C66H93N15O18S2
- Molecular Weight:
- 1448.660
- Log P:
- 3.1315
- Hydrogen Bond Acceptor:
- 34
- Hydrogen Bond Donor:
- 17
- TPSA:
- 593.09
- CAS Number(s):
- 37209-62-4
Synonym(s)
1.
syntometrine
2.
oxymetrin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 11 | US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 3 | Medication Error | FAERS: 2 | US FAERS | |
| 4 | Uterine contractions during pregnancy | FAERS: 2 | US FAERS | |
| 5 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 6 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 7 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 8 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 9 | Bronchospasm | FAERS: 1 | US FAERS | |
| 10 | Chest Pain | FAERS: 1 | US FAERS | |
| 11 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 12 | Drug administration error | FAERS: 1 | US FAERS | |
| 13 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 14 | Hypoxia | FAERS: 1 | US FAERS | |
| 15 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 16 | Myocardial Infarction | FAERS: 1 | 10618345 | CTD US FAERS |
| 17 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 18 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 19 | Product quality issue | FAERS: 1 | US FAERS | |
| 20 | Vomiting | FAERS: 1 | 8251842 | CTD US FAERS |
| 21 | Nausea | 8251842 | CTD | |
| 22 | Postpartum Hemorrhage | 11905429 | CTD | |
| 23 | Visual Impairment | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.