3-[[2-(Diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-[4-(2-methylpropyl)phenyl]propanoic acid
(AULFVKUUIUIWQU-UHFFFAOYSA-N)
Structure
- SMILES
- CC(Cc1ccc(cc1)C(C(=O)O)C)C.NC(=Nc1scc(n1)CSCCC(=NS(=O)(=O)N)N)N
- Molecular Formula:
- C21H33N7O4S3
- Molecular Weight:
- 543.726
- Log P:
- 6.1872
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 275.05
- CAS Number(s):
- 1011231-26-7
Synonym(s)
1.
3-[[2-(Diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-[4-(2-methylpropyl)phenyl]propanoic acid
2.
Duexis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal discomfort | FAERS: 28 | US FAERS | |
| 2 | Therapy cessation | FAERS: 22 | US FAERS | |
| 3 | Drug ineffective | FAERS: 20 | US FAERS | |
| 4 | Pain | FAERS: 20 | US FAERS | |
| 5 | Headache | FAERS: 15 | US FAERS | |
| 6 | Nausea | FAERS: 15 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 8 | Dizziness | FAERS: 10 | US FAERS | |
| 9 | Insurance issue | FAERS: 10 | US FAERS | |
| 10 | Drug dose omission | FAERS: 8 | US FAERS | |
| 11 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 12 | Chest Pain | FAERS: 7 | US FAERS | |
| 13 | Inability to afford medication | FAERS: 7 | US FAERS | |
| 14 | Arthralgia | FAERS: 6 | US FAERS | |
| 15 | Dyspepsia | FAERS: 6 | US FAERS | |
| 16 | Palpitations | FAERS: 5 | US FAERS | |
| 17 | Urticaria | FAERS: 5 | US FAERS | |
| 18 | Vomiting | FAERS: 5 | US FAERS | |
| 19 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 21 | Constipation | FAERS: 4 | US FAERS | |
| 22 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 23 | Malaise | FAERS: 4 | US FAERS | |
| 24 | Pruritus | FAERS: 4 | US FAERS | |
| 25 | Ulcer | FAERS: 4 | US FAERS | |
| 26 | Fatigue | FAERS: 3 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 28 | Lip swelling | FAERS: 3 | US FAERS | |
| 29 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 30 | Product supply issue | FAERS: 3 | US FAERS | |
| 31 | Tremor | FAERS: 3 | US FAERS | |
| 32 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 33 | Alopecia | FAERS: 2 | US FAERS | |
| 34 | Anxiety | FAERS: 2 | US FAERS | |
| 35 | Back Pain | FAERS: 2 | US FAERS | |
| 36 | Chest discomfort | FAERS: 2 | US FAERS | |
| 37 | Erythema | FAERS: 2 | US FAERS | |
| 38 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 39 | Gastritis | FAERS: 2 | US FAERS | |
| 40 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 41 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 42 | Joint swelling | FAERS: 2 | US FAERS | |
| 43 | Menorrhagia | FAERS: 2 | US FAERS | |
| 44 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 45 | Somnolence | FAERS: 2 | US FAERS | |
| 46 | Throat irritation | FAERS: 2 | US FAERS | |
| 47 | Acne | FAERS: 1 | US FAERS | |
| 48 | Arthropod bite | FAERS: 1 | US FAERS | |
| 49 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 50 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 51 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 52 | Blood urea increased | FAERS: 1 | US FAERS | |
| 53 | Blood urine present | FAERS: 1 | US FAERS | |
| 54 | Burning sensation | FAERS: 1 | US FAERS | |
| 55 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 56 | Cold sweat | FAERS: 1 | US FAERS | |
| 57 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 58 | Drug screen positive | FAERS: 1 | US FAERS | |
| 59 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 60 | Epistaxis | FAERS: 1 | US FAERS | |
| 61 | Eye irritation | FAERS: 1 | US FAERS | |
| 62 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 63 | Flushing | FAERS: 1 | US FAERS | |
| 64 | Fracture | FAERS: 1 | US FAERS | |
| 65 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 66 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 67 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 68 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 69 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 70 | Influenza | FAERS: 1 | US FAERS | |
| 71 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 72 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 73 | Lichen Planus | FAERS: 1 | US FAERS | |
| 74 | Limb discomfort | FAERS: 1 | US FAERS | |
| 75 | Limb injury | FAERS: 1 | US FAERS | |
| 76 | Medication Error | FAERS: 1 | US FAERS | |
| 77 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 78 | Mood swings | FAERS: 1 | US FAERS | |
| 79 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 80 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 81 | Myalgia | FAERS: 1 | US FAERS | |
| 82 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 83 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 84 | Polyuria | FAERS: 1 | US FAERS | |
| 85 | Product dose omission | FAERS: 1 | US FAERS | |
| 86 | Product physical issue | FAERS: 1 | US FAERS | |
| 87 | Product quality issue | FAERS: 1 | US FAERS | |
| 88 | Product use issue | FAERS: 1 | US FAERS | |
| 89 | Rash erythematous | FAERS: 1 | US FAERS | |
| 90 | Retching | FAERS: 1 | US FAERS | |
| 91 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 92 | Skin irritation | FAERS: 1 | US FAERS | |
| 93 | Tachycardia | FAERS: 1 | US FAERS | |
| 94 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 95 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 96 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 97 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 98 | Wheezing | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.