clindamycin phosphate benzoyl peroxide combination
(APQDBWGZCQHKHQ-SHSUDHJHSA-N)
Structure
- SMILES
- O=C(c1ccccc1)OOC(=O)c1ccccc1.CCC[C@H]1CN([C@@H](C1)C(=O)N[C@@H]([C@H]1O[C@H](SC)[C@@H]([C@H]([C@H]1O)O)OP(=O)(O)O)[C@@H](Cl)C)C
- Molecular Formula:
- C32H44ClN2O12PS
- Molecular Weight:
- 747.190
- Log P:
- 3.4507
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 5
- TPSA:
- 236.5
- CAS Number(s):
- N/A
Synonym(s)
1.
clindamycin phosphate benzoyl peroxide combination
2.
BenzaClin
3.
Duac gel
4.
benzoyl peroxide clindamycin phosphate combination
5.
benzoyl peroxide, clindamycin drug combination
6.
clindoxyl
7.
clindoxyl gel
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Erythema | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Product quality issue | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Application site erythema | FAERS: 7 | US FAERS | |
| 5 | Expired product administered | FAERS: 7 | US FAERS | |
| 6 | Acne | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Application site pain | FAERS: 5 | US FAERS | |
| 8 | Application site pruritus | FAERS: 5 | US FAERS | |
| 9 | Application site swelling | FAERS: 5 | US FAERS | |
| 10 | No adverse event | FAERS: 5 | US FAERS | |
| 11 | Pruritus | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Application site irritation | FAERS: 3 | US FAERS | |
| 13 | Dry skin | FAERS: 3 | US FAERS | |
| 14 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 15 | Application site dryness | FAERS: 2 | US FAERS | |
| 16 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 17 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 18 | Rash erythematous | FAERS: 2 | US FAERS | |
| 19 | Skin reaction | FAERS: 2 | US FAERS | |
| 20 | effusion | FAERS: 2 | US FAERS | |
| 21 | Angioedema | FAERS: 1 | US FAERS | |
| 22 | Application site erosion | FAERS: 1 | US FAERS | |
| 23 | Application site macule | FAERS: 1 | US FAERS | |
| 24 | Application site rash | FAERS: 1 | US FAERS | |
| 25 | Application site reaction | FAERS: 1 | US FAERS | |
| 26 | Application site warmth | FAERS: 1 | US FAERS | |
| 27 | Burning sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Colitis | FAERS: 1 | US FAERS | |
| 29 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 30 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 31 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 32 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 33 | Miliaria | FAERS: 1 | US FAERS | |
| 34 | Nausea | FAERS: 1 | US FAERS | |
| 35 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 36 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 37 | Pain of skin | FAERS: 1 | US FAERS | |
| 38 | Papule | FAERS: 1 | US FAERS | |
| 39 | Product deposit | FAERS: 1 | US FAERS | |
| 40 | Product use issue | FAERS: 1 | US FAERS | |
| 41 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 42 | Skin irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Tongue blistering | FAERS: 1 | US FAERS | |
| 45 | Weight decreased | FAERS: 1 | US FAERS | |
| 46 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 47 | Urticaria | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120263
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.