Technivie
(AKWYQCOPWKTDIP-SRFJDUAHSA-N)
Structure
- SMILES
- O=C(N[C@H](C(C[C@H](Cc1ccccc1)NC(=O)C(C(C)C)NC(=O)N(Cc1csc(n1)C(C)C)C)O)Cc1ccccc1)OCc1cncs1.Cc1ncc(nc1)C(=O)N[C@H]1CCCCC/C=C\[C@H]2[C@](NC(=O)[C@H]3N(C1=O)C[C@@H](C3)Oc1nc3ccccc3c3c1cccc3)(C2)C(=O)NS(=O)(=O)C1CC1.COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc(cc1)[C@@H]1CC[C@H](N1c1ccc(cc1)C(C)(C)C)c1ccc(cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C
- Molecular Formula:
- C127H158N20O20S3
- Molecular Weight:
- 2380.930
- Log P:
- 21.3998
- Hydrogen Bond Acceptor:
- 42
- Hydrogen Bond Donor:
- 11
- TPSA:
- 579.01
- CAS Number(s):
- N/A
Synonym(s)
1.
Technivie
External Link(s)
| PubChem Compound | 91824755 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 2 | US FAERS | |
| 2 | Headache | FAERS: 2 | US FAERS | |
| 3 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 4 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 5 | Asthenia | FAERS: 1 | US FAERS | |
| 6 | Chest discomfort | FAERS: 1 | US FAERS | |
| 7 | Dehydration | FAERS: 1 | US FAERS | |
| 8 | Dizziness | FAERS: 1 | US FAERS | |
| 9 | Fatigue | FAERS: 1 | US FAERS | |
| 10 | Hepatitis C | FAERS: 1 | US FAERS | |
| 11 | Joint swelling | FAERS: 1 | US FAERS | |
| 12 | Vaginal Fistula | FAERS: 1 | US FAERS | |
| 13 | Vomiting | FAERS: 1 | US FAERS | |
| 14 | Drug ineffective | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120265
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.