Ferric citrate monohydrate
(AJVRSHNXSHMMCH-UHFFFAOYSA-K)
Structure
- SMILES
- [O-]C(=O)C(CC(=O)[O-])(CC(=O)[O-])O.O.[Fe+3]
- Molecular Formula:
- C6H7FeO8
- Molecular Weight:
- 262.960
- Log P:
- -5.3194
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 149.85
- CAS Number(s):
- 2338-05-8; 17217-76-4; 153531-98-7; 334024-15-6
Synonym(s)
1.
Ferric citrate monohydrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 2 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 3 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 4 | Brain Contusion | FAERS: 2 | US FAERS | |
| 5 | Pneumonia | FAERS: 2 | US FAERS | |
| 6 | Sepsis | FAERS: 2 | US FAERS | |
| 7 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 8 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 9 | Fracture | FAERS: 1 | US FAERS | |
| 10 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 11 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 12 | Ileus | FAERS: 1 | US FAERS | |
| 13 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 14 | Marasmus | FAERS: 1 | US FAERS | |
| 15 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 16 | Peritonitis | FAERS: 1 | US FAERS | |
| 17 | Shunt stenosis | FAERS: 1 | US FAERS | |
| 18 | Tremor | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.