Binimetinib
(ACWZRVQXLIRSDF-UHFFFAOYSA-N)
Structure
- SMILES
- OCCONC(=O)c1cc2n(C)cnc2c(c1Nc1ccc(cc1F)Br)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE41
- Molecular Formula:
- C17H15BrF2N4O3
- Molecular Weight:
- 441.227
- Log P:
- 3.4752
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 88.41
- CAS Number(s):
- 606143-89-9
Synonym(s)
1.
Binimetinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 2 | US FAERS | |
| 2 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 3 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 4 | Alopecia | FAERS: 1 | US FAERS | |
| 5 | Diplopia | FAERS: 1 | US FAERS | |
| 6 | Disease Progression | FAERS: 1 | US FAERS | |
| 7 | Drug ineffective | FAERS: 1 | US FAERS | |
| 8 | Dysgeusia | FAERS: 1 | US FAERS | |
| 9 | Muscle strain | FAERS: 1 | US FAERS | |
| 10 | Pain of skin | FAERS: 1 | US FAERS | |
| 11 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 12 | Photophobia | FAERS: 1 | US FAERS | |
| 13 | Product dose omission | FAERS: 1 | US FAERS | |
| 14 | Tumour haemorrhage | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.