Index SMILES Probability Label Compound_1 CC[C@@H]([C@@H]1NC(=O)C(=C1O)C(=O)C)C 0.16 0.0